LN7528249
90%
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB6320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65oC |
| Boiling point: | 623.1±55.0 °C(Predicted) |
| Density | 1.475±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | 13.23±0.70(Predicted) |
| form | Solid |
| color | Off-White |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | UABOQFANGSVXKK-JNTNYNDRNA-N |
| SMILES | O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1C1=CC=C(Br)C(CC2=CC=C(OCC)C=C2)=C1 |&1:1,4,6,8,10,r| |
Description and Uses
Deschloro Dapagliflozin is an impurity of Dapagliflozin (D185370), a sodium-glucose transporter 2 inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H319-H372-H411 |
| Precautionary statements | P260-P264-P273-P301+P312-P305+P351+P338-P314 |
| target organs | Kidney |
| WGK Germany | WGK 2 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 STOT RE 1 |








![(3R,4R)-3-[(6-amino-4-pyrimidinyl)methylamino]-4-methyl-β-oxo-1-Piperidinepropanenitrile](https://img.chemicalbook.com/CAS/20181212/GIF/1640971-60-3.gif)
