LN7636646
Fluopicolide , Analysis standard reagent , 239110-15-7
CAS NO.:239110-15-7
Empirical Formula: C14H8Cl3F3N2O
Molecular Weight: 383.58
MDL number: MFCD09751509
EINECS: 259-565-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150 °C |
| Boiling point: | 432.1±45.0 °C(Predicted) |
| Density | 1.515±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Sonicated) |
| pka | 11.14±0.46(Predicted) |
| form | Solid |
| color | Off-White to Light Yellow |
| Henry's Law Constant | 9.0×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H8Cl3F3N2O/c15-8-2-1-3-9(16)12(8)13(23)22-6-11-10(17)4-7(5-21-11)14(18,19)20/h1-5H,6H2,(H,22,23) |
| InChIKey | GBOYJIHYACSLGN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cnc(CNC(=O)c2c(Cl)cccc2Cl)c(Cl)c1 |
| LogP | 3.820 (est) |
| EPA Substance Registry System | Benzamide, 2,6-dichloro-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methyl]- (239110-15-7) |
Description and Uses
Fluopicolide is a fungicide used for the control of a range of Oomycete diseases including downy mildew and blight. It has a low aqueous solubility and is not highly volatile. It tends to be fairly persistent in most soil systems and stable in water-sediment systems. There is also a risk of it leaching to groundwater. No significant risks to human health have been identified. It is moderately toxic to most biodiversity but there is less of a risk to bees.
Fluopicolide is a useful chemical that kills oomycetes in vitro.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 239110-15-7(Hazardous Substances Data) |






