PRODUCT Properties
| Melting point: | 44-45 °C(lit.) |
| Boiling point: | 127-140 °C0.1 mm Hg(lit.) |
| Density | 1.2611 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| Flash point: | >230 °F |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.62±0.10(Predicted) |
| color | White to Pale Red |
| InChI | 1S/C11H15NO5/c1-14-7-5-6(11(13)17-4)8(12)10(16-3)9(7)15-2/h5H,12H2,1-4H3 |
| InChIKey | UPVUQELOASQBMY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1N |
| CAS DataBase Reference | 5035-82-5(CAS DataBase Reference) |
Description and Uses
Methyl 2-Amino-3,4,5-trimethoxybenzoate could be a constituent contributing to the aroma of green tea leaves.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
