PRODUCT Properties
| Melting point: | ~30 °C |
| Boiling point: | 214-216 °C (lit.) |
| Density | 1.574 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Acetonitrile (Soluble), Chloroform (Soluble) |
| form | Liquid After Melting |
| color | Clear colorless |
| Sensitive | Moisture Sensitive |
| BRN | 512173 |
| Stability: | Moisture sensitive |
| InChI | 1S/C4H2Cl4O3/c5-1(6)3(9)11-4(10)2(7)8/h1-2H |
| InChIKey | RQHMQURGSQBBJY-UHFFFAOYSA-N |
| SMILES | ClC(Cl)C(=O)OC(=O)C(Cl)Cl |
| CAS DataBase Reference | 4124-30-5 |
| EPA Substance Registry System | Acetic acid, dichloro-, anhydride (4124-30-5) |
Description and Uses
Dichloroacetic anhydride was employed as an acylating agent for acylation of 10-Deacetylbaccatin III using Pseudomonas cepacia. It was also used in the preparation of cellulose dichloroacetates.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H311-H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 3 |
| RTECS | AG6300000 |
| F | 21 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29154000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Eye Dam. 1 Skin Corr. 1B |





