LN8147525
Orciprenaline sulfate , 98% , 5874-97-5
Synonym(s):
Metaproterenol hemisulfate salt
CAS NO.：5874-97-5
Empirical Formula: C22H36N2O10S
Molecular Weight: 520.59
MDL number: MFCD00058303
EINECS: 227-539-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB460.00 | In Stock |
|
| 1mL*10mM(inDMSO) | RMB504.00 | In Stock |
|
| 100mg | RMB784.00 | In Stock |
|
| 200mg | RMB1019.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-203° |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, slightly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/2C11H17NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,11-15H,6H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | MKFFGUZYVNDHIH-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.CC(C)NCC(O)c1cc(O)cc(O)c1.CC(C)NCC(O)c2cc(O)cc(O)c2 |
Description and Uses
Bronchodilatator;Beta-adrenergic agonist
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332 |
| Precautionary statements | P261-P271-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20 |
| Safety Statements | 36 |
| WGK Germany | 2 |
| RTECS | DO2275000 |
| HS Code | 2922504500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation |
| Toxicity | LD50 in rats (mg/kg): 42 orally (Goldenthal) |
