LN8302746
Piperophos , Analysis standard reagent , 24151-93-7
CAS NO.：24151-93-7
Empirical Formula: C14H28NO3PS2
Molecular Weight: 353.48
MDL number: MFCD00210346
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 250°C |
| Density | 1.153±0.06 g/cm3(Predicted) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| pka | -0.87±0.40(Predicted) |
| form | liquid |
| Water Solubility | 25mg/L(20 ºC) |
| BRN | 8395577 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C14H28NO3PS2/c1-4-10-17-19(20,18-11-5-2)21-12-14(16)15-9-7-6-8-13(15)3/h13H,4-12H2,1-3H3 |
| InChIKey | UNLYSVIDNRIVFJ-UHFFFAOYSA-N |
| SMILES | CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C |
| EPA Substance Registry System | Phosphorodithioic acid, S-[2-(2-methyl-1-piperidinyl)-2-oxoethyl] O,O-dipropyl ester (24151-93-7) |
Description and Uses
Piperophos is a pesticide used in agriculture for prevention of fungal diseases and insect infestation.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H330-H410 |
| Precautionary statements | P273-P301+P312+P330-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TE3690000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
