PRODUCT Properties
| Melting point: | 142-145 °C |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| pka | 9.39±0.10(Predicted) |
| InChI | InChI=1S/C10H14N2O6/c1-17-8-5(4-13)18-9(7(8)15)12-3-2-6(14)11-10(12)16/h2-3,5,7-9,13,15H,4H2,1H3,(H,11,14,16)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | YKNATSNMFLEFRB-ZOQUXTDFSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@H](O)[C@@H]1OC |
Description and Uses
3’-O-Methyluridine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1].
Safety
| WGK Germany | 3 |
| HS Code | 29349990 |






