LN8378846
Diclofop-methyl , Analysis standard reagent , 51338-27-3
CAS NO.:51338-27-3
Empirical Formula: C16H14Cl2O4
Molecular Weight: 341.19
MDL number: MFCD00128052
EINECS: 257-141-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB634.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-41°C |
| Boiling point: | 173-175°C (0.1 mbar) |
| Density | 1.3 |
| refractive index | 1.5300 (estimate) |
| storage temp. | 0-6°C |
| form | Solid |
| color | White to off-white |
| Water Solubility | 0.005 g/100 mL |
| Merck | 13,3109 |
| BRN | 2224754 |
| InChI | 1S/C16H14Cl2O4/c1-10(16(19)20-2)21-12-4-6-13(7-5-12)22-15-8-3-11(17)9-14(15)18/h3-10H,1-2H3 |
| InChIKey | BACHBFVBHLGWSL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| LogP | 4.620 |
| CAS DataBase Reference | 51338-27-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2-[4-(2,4-dichlorophenoxy)phenoxy]-, methyl ester(51338-27-3) |
| EPA Substance Registry System | Diclofop methyl (51338-27-3) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | UF1180000 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 51338-27-3(Hazardous Substances Data) |
| Toxicity | dog,LD50,oral,1600mg/kg (1600mg/kg),"Agrochemicals Handbook," with updates, Hartley, D., and H. Kidd, eds., Nottingham, Royal Soc of Chemistry, 1983-86Vol. A138, Pg. 1983, |





