PRODUCT Properties
| Melting point: | 316-326°C |
| Boiling point: | 376.62°C (rough estimate) |
| Density | d20 1.32 kg/l |
| refractive index | 1.6450 (estimate) |
| storage temp. | 0-6°C |
| form | Solid |
| pka | 10.66±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | 6mg/L(25 ºC) |
| Merck | 13,5455 |
| Major Application | agriculture environmental |
| InChI | 1S/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) |
| InChIKey | ZTMKADLOSYKWCA-UHFFFAOYSA-N |
| SMILES | O=C1NC2=C(CCC2)C(=O)N1C3CCCCC3 |
| LogP | 2.860 (est) |
| CAS DataBase Reference | 2164-08-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Lenacil(2164-08-1) |
| EPA Substance Registry System | Lenacil (2164-08-1) |
Description and Uses
Lenacil is an herbicide used in the protection of crops. Non-cytotoxic agent.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H410 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P273-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | WGK 2 |
| RTECS | GY5875000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Toxicity | LD50 (80% wettable powder) orally in rats: >11,000 mg/kg; LC50 96 hr in bluegill sunfish; rainbow trout: 100-1000; 135 mg/l; LC50 8 day in bobwhite quail, Peking duck (mg/kg): 2300, >5620. (DuPont technical data sheet) |
