LN8623646
Mepronil , 99.5%(analysis standard reagent) , 55814-41-0
Synonym(s):
3′-Isopropoxy-2-methylbenzanilide
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB837.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-89°C |
| Boiling point: | 412.48°C (rough estimate) |
| Density | 1.0483 (rough estimate) |
| vapor pressure | 5.6 x 10-5 Pa (20 °C) |
| refractive index | 1.5400 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| Water Solubility | 12 mg l-1(20 °C) |
| pka | 13.10±0.70(Predicted) |
| color | White |
| BRN | 2381749 |
| Major Application | agriculture environmental |
| InChI | 1S/C17H19NO2/c1-12(2)20-15-9-6-8-14(11-15)18-17(19)16-10-5-4-7-13(16)3/h4-12H,1-3H3,(H,18,19) |
| InChIKey | BCTQJXQXJVLSIG-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cccc(NC(=O)c2ccccc2C)c1 |
| CAS DataBase Reference | 55814-41-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Mepronil(55814-41-0) |
| EPA Substance Registry System | Mepronil (55814-41-0) |
Description and Uses
Mepronil is used to control Basidiomycetes diseases in rice, cereals, potatoes, vegetables, sugar beet, fruit, vines, tobacco, turf grass and other crops.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | CV5581700 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in rabbit: > 10gm/kg |
