LN8648358
Fosfenopril , 98% , 95399-71-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB6406.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >3000C |
| alpha | D -24° (c = 1 in methanol) |
| Boiling point: | 728.9±60.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 2.75±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | WOIWWYDXDVSWAZ-RTWAWAEBSA-N |
| SMILES | [P](=O)(O)(CCCCc3ccccc3)CC(=O)N1[C@@H](C[C@H](C1)C2CCCCC2)C(=O)O |
Description and Uses
A metabolite of Fosinopril, a phosphinic acid containing angiotensin converting enzyme (ACE) inhibitor
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| WGK Germany | 3 |
| HS Code | 2933995300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1A |





