PRODUCT Properties
| Boiling point: | 462.6±45.0 °C(Predicted) |
| Density | 1.499±0.06 g/cm3(Predicted) |
| solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly) |
| pka | 1.75±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | detection |
| InChI | 1S/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | DWPCPZJAHOETAG-UHFFFAOYSA-N |
| SMILES | S(CC(N)C(=O)O)CC(N)C(=O)O |
| CAS DataBase Reference | 3183-08-2(CAS DataBase Reference) |
Description and Uses
DL-Lanthionine is a thioether-amino acid which when present in peptides results in antimicrobial activity. Peptides with this amino acid within it become part of a group named lantibiotics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
