LN9049857
1,3-Dioxo-1H,3H-benzo[de]isochromene-6,7-dicarboxylicacid , 52671-72-4
Synonym(s):
1,3-Dioxo-1H,3H-naphtho[1,8-c,d]pyran-6,7-dicarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 25g | RMB897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 692.8±45.0 °C(Predicted) |
| Density | 1.769 |
| form | Powder |
| pka | 0.88±0.20(Predicted) |
| InChI | 1S/C14H6O7/c15-11(16)5-1-3-7-10-8(14(20)21-13(7)19)4-2-6(9(5)10)12(17)18/h1-4H,(H,15,16)(H,17,18) |
| InChIKey | YQXRNSHBINARCY-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc2C(=O)OC(=O)c3ccc(C(O)=O)c1c23 |
Description and Uses
1,4,5,8-Naphthalenetetracarboxylic Acid 1,8-Monoanhydride can be used for graphene compositions.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H400 |
| Precautionary statements | P273-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3077 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 |
| REACH Registrations | Active |

![1,3-Dioxo-1H,3H-benzo[de]isochromene-6,7-dicarboxylicacid](https://img.chemicalbook.com/CAS/GIF/52671-72-4.gif)



