LN925475
≥98% , 84485-00-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-200°C |
| storage temp. | room temp |
| solubility | Soluble to 5 mM in water and to 100 mM in DMSO |
| form | Powder |
| Major Application | clinical testing |
| InChI | 1S/C17H26ClN.ClH.H2O/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14;;/h6-9,13,16H,5,10-12H2,1-4H3;1H;1H2 |
| InChIKey | KFNNPQDSPLWLCX-UHFFFAOYSA-N |
| SMILES | O.Cl.CC(C)CC(N(C)C)C1(CCC1)c2ccc(Cl)cc2 |
| CAS DataBase Reference | 84485-00-7(CAS DataBase Reference) |
Description and Uses
Anorexic; antidepressant.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P233-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| target organs | Eyes,Central nervous system |
| WGK Germany | WGK 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
