![2-Methyl-1,3,4,14b-tetrahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepin-10(2H)-one](https://img.chemicalbook.com/CAS/GIF/191546-97-1.gif)
LN9411858
2-Methyl-1,3,4,14b-tetrahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepin-10(2H)-one , 191546-97-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB2256.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149°C |
| Boiling point: | 459.9±45.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.00±0.20(Predicted) |
| color | Pale Yellow to Beige |
| Major Application | pharmaceutical |
| InChI | 1S/C17H17N3O/c1-19-9-10-20-15(11-19)12-5-2-3-6-13(12)16(21)14-7-4-8-18-17(14)20/h2-8,15H,9-11H2,1H3 |
| InChIKey | RZDFSDWHGNDESU-UHFFFAOYSA-N |
| SMILES | N21C(CN(CC2)C)c3c(cccc3)C(=O)c4c1nccc4 |
Description and Uses
10-Oxo Mirtazapine (Mirtazapine Impurity F) is an impurity of Mirtazapine. Mirtazapine EP Impurity F.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H411-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933599550 |
| Storage Class | 13 - Non Combustible Solids |
