PRODUCT Properties
| Melting point: | 122-123℃ |
| Boiling point: | 547.24°C (rough estimate) |
| Density | 1.8769 (rough estimate) |
| vapor pressure | 2.9 x 10-4 Pa (25 °C) |
| refractive index | 1.6000 (estimate) |
| Water Solubility | 0.025 mg l-1 |
| Merck | 13,3131 |
| BRN | 2064747 |
| Major Application | agriculture environmental |
| InChI | 1S/C10Cl10/c11-1-2(12)6(16)9(19,5(1)15)10(20)7(17)3(13)4(14)8(10)18 |
| InChIKey | LWLJUMBEZJHXHV-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(Cl)(C(Cl)=C1Cl)C2(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl |
| EPA Substance Registry System | Dienochlor (2227-17-0) |
Description and Uses
Acaricide used for control of mites on ornamentals.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24 |
| RIDADR | 2761 |
| WGK Germany | 3 |
| RTECS | DT8225000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 2227-17-0(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for male albino rats >3.16 g/kg, bobwhite quail 705 mg/kg (Worthing and Hance, 1991). |
