LN9570646
Dibrom , Analysis standard reagent , 300-76-5
Synonym(s):
(1,2-Dibromo-2,2-dichloroethyl) dimethyl phosphate;Bromchlophos;Naled
CAS NO.:300-76-5
Empirical Formula: C4H7Br2Cl2O4P
Molecular Weight: 380.78
MDL number: MFCD00053227
EINECS: 206-098-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212℃ (decomposition) |
| Boiling point: | 110℃ (0.5 Torr) |
| Density | 1.96 g/cm3 |
| vapor pressure | 2 (quoted, Verschueren, 1983) |
| refractive index | 1.5108 (28℃) |
| storage temp. | 0-6°C |
| solubility | Freely soluble in ketone, alcohols, aromatic and chlorinated hydrocarbons but sparingly soluble in
petroleum solvents and mineral oils (Windholz et al., 1983) |
| form | solid |
| Water Solubility | 2000mg l-1(20 °C) |
| Specific Gravity | 1.96 (20℃) |
| Merck | 13,6384 |
| BRN | 2049930 |
| Exposure limits | NIOSH REL: TWA 3 mg/m3, IDLH 200 mg/m3; OSHA PEL: TWA 3
mg/m3; ACGIH TLV: TWA 3 mg/m3. |
| Stability: | Light Sensitive, Moisture Sensitive |
| Major Application | agriculture environmental |
| InChI | 1S/C4H7Br2Cl2O4P/c1-10-13(9,11-2)12-3(5)4(6,7)8/h3H,1-2H3 |
| InChIKey | BUYMVQAILCEWRR-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)OC(Br)C(Cl)(Cl)Br |
| EPA Substance Registry System | Naled (300-76-5) |
Description and Uses
Sensitization to Naled seems to be rare.
Insecticide used for control of spider mites, sucking and chewing insects in fruits, vegetables and ornamentals. Its use may be restricted.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H400 |
| Precautionary statements | P264-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N,T |
| Risk Statements | 21/22-36/38-50-25-21 |
| Safety Statements | 36/37-61-26 |
| RIDADR | 3018 |
| OEB | B |
| OEL | TWA: 3 mg/m3 [skin] |
| WGK Germany | 3 |
| RTECS | TB9450000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29199000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 300-76-5(Hazardous Substances Data) |
| Toxicity | LD50 in male rats (mg/kg): 250 orally; 800 dermally (Gaines) |
| IDLA | 200 mg/m3 |




