LN9600057
2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene , 98% , 1099597-86-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB302.40 | In Stock |
|
| 1g | RMB800.80 | In Stock |
|
| 5g | RMB2800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 149.1±35.0 °C(Predicted) |
| Density | 1.768±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | solid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C7H2BrF5/c8-6-4(7(11,12)13)1-3(9)2-5(6)10/h1-2H |
| InChIKey | IJQIBUQQMOIJPX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(c(cc(c1)F)F)Br |
Description and Uses
2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene is a derivative compound of bromodifluorobenzene (348-57-2), used in the preparation of a alkylarylbenzothiophene as a GPR52 agonist.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
