PRODUCT Properties
| Melting point: | 256-259 °C(lit.) |
| Boiling point: | 411.7±24.0 °C(Predicted) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| pka | 4.12±0.15(Predicted) |
| form | solid |
| BRN | 1379389 |
| InChI | 1S/C16H16N2O2/c1-17(2)15-9-5-13(6-10-15)3-4-14-7-11-16(12-8-14)18(19)20/h3-12H,1-2H3/b4-3+ |
| InChIKey | NVLSIZITFJRWPY-ONEGZZNKSA-N |
| SMILES | CN(C)c1ccc(\C=C\c2ccc(cc2)[N+]([O-])=O)cc1 |
Description and Uses
4-Dimethylamino-4''-nitrostilbene is a useful standard for the correction of emission of fluorescence spectrometers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
