M0017453
(S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide , >95% , 102767-31-7
Synonym(s):
(R)-(+)-α-Methylbenzylamine;(R)-(+)-1-Phenylethylamine;(S)-N-[1-(Aminocarbonyl)propyl]-4-chlorobutanamide;(S)-N-(1-amino-1-oxobutan-2-yl)-4-chlorobutanamide
CAS NO.：102767-31-7
Empirical Formula: C8H15ClN2O2
Molecular Weight: 206.67
MDL number: MFCD09955129
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB960.00 | In Stock |
|
| 250mg | RMB2000.00 | In Stock |
|
| 1g | RMB4480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 453.2±30.0 °C(Predicted) |
| Density | 1.154±0.06 g/cm3(Predicted) |
| pka | 14.54±0.46(Predicted) |
| BRN | 13476773 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C8H15ClN2O2/c1-2-6(8(10)13)11-7(12)4-3-5-9/h6H,2-5H2,1H3,(H2,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | QBJNYRYTZPBHFT-LURJTMIESA-N |
| SMILES | C(N[C@H](C(N)=O)CC)(=O)CCCCl |
Description and Uses
(S)-N-(1-Amino-1-oxobutan-2-yl)-4-chlorobutanamide is a related compound of Levetiracetam (L331500). Levetiracetam related compound A.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| HS Code | 2924190002 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
