M0196735
BenzylButylPhthalate-d4 , ≥98atom%D , 93951-88-3
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB338.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.114 g/mL at 25 °C |
| Flash point: | 113 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C19H20O4/c1-2-3-13-22-18(20)16-11-7-8-12-17(16)19(21)23-14-15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3/i7D,8D,11D,12D |
| InChIKey | IRIAEXORFWYRCZ-CXRURWBMSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCc2ccccc2)c(c1[2H])C(=O)OCCCC |
| CAS Number Unlabeled | 85-68-7 |
Description and Uses
Labelled Benzyl Butyl Phthalate (B233555). A phthalate metabolite with genotoxic effect.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360-H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | T,N |
| Risk Statements | 61-50/53-62 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
