M0230735
Bovinicacid? , ≥99%,356mMinEthanol , 2540-56-9
Synonym(s):
(9Z,11E)-9,11-Octadecadienoic acid;9Z,11E-CLA;Bovinic acid;Linoleic acid (9-cis, 11-trans)
| Pack Size | Price | Stock | Quantity |
| 50μl | RMB720.00 | In Stock |
|
| 250μl | RMB2000.00 | In Stock |
|
| 1ml | RMB5744.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 381.6±11.0 °C(Predicted) |
| Density | 0.911±0.06 g/cm3(Predicted) |
| refractive index | n20/D1.481 |
| storage temp. | −20°C |
| solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) |
| form | Liquid |
| pka | 4.78±0.10(Predicted) |
| color | Colorless to light yellow |
| biological source | synthetic |
| Stability: | Light Sensitive |
| InChI | 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9- |
| InChIKey | JBYXPOFIGCOSSB-GOJKSUSPSA-N |
| SMILES | CCCCCC\C=C\C=C/CCCCCCCC(O)=O |
Description and Uses
Rumenic Acid is a trans fatty acid that may potentially reduce the risk of cancer and cardiovascular diseases.?It may also prevent disease processes that lead to chronic inflammation, atherosclerosis, and diabetes.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H350 |
| Precautionary statements | P201-P202-P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P308+P313-P370+P378-P403+P235-P405-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 24-36/37-45 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |








