M0469650
IristectorigeninB , Analysis of control products, 98% , 86849-77-6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 621.2±55.0 °C(Predicted) |
| Density | 1.483±0.06 g/cm3(Predicted) |
| pka | 6.43±0.20(Predicted) |
| form | Solid |
| color | Off-white to yellow |
| InChI | InChI=1S/C17H14O7/c1-22-12-4-3-8(5-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3 |
| InChIKey | WRZOUWHPDDOJNR-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1C1=CC=C(OC)C(O)=C1 |
Description and Uses
Iristectorigenin B (Iristectrigenin B) is a liver X receptor (LXR) modulator. Iristectrigenin B stimulates the transcriptional activity of both LXR-α and LXR-β[1].
