PRODUCT Properties
| Melting point: | 135° |
| alpha | D20 +311° (c = 0.8 in alc) |
| Boiling point: | 499.57°C (rough estimate) |
| Density | 1.1771 (rough estimate) |
| refractive index | 1.5614 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 6.57±0.40(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C22H27NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-11,13,21H,8-9,12H2,1-5H3/t13-,21+/m0/s1 |
| InChIKey | VRSRXLJTYQVOHC-YEJXKQKISA-N |
| SMILES | C12=CC(OC)=C(OC)C=C1CCN1[C@]2([H])[C@@H](C)C2=CC=C(OC)C(OC)=C2C1 |
Description and Uses
Corydaline is a common herbal drug used in Chinese medicine and is touted as an analgesic with reported anti-angiogenic effects.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271 |
| HS Code | 2939799090 |
| Toxicity | LD50 in mice (mg/kg): 135.5 ± 12.8 i.v. (Anderson, Chen) |






