M0895335
Cynaropicrin? , ≥97% , 35730-78-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB4104.00 | In Stock |
|
| 10mg | RMB5928.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 566.2±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C, protect from light |
| solubility | DMSO:50.0(Max Conc. mg/mL);144.35(Max Conc. mM) |
| pka | 13.52±0.10(Predicted) |
| form | Oil |
| color | Off-white to light yellow |
| biological source | plant |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h12-17,20-21H,1-7H2/t12-,13-,14-,15-,16+,17+/m0/s1 |
| InChIKey | KHSCYOFDKADJDJ-NQLMQOPMSA-N |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](C[C@@H](C3=C)O)C(=C)C[C@@H]([C@H]2C(=C)C1=O)OC(=O)C(=C)CO |
| LogP | 1.340 (est) |
Description and Uses
Cynaropicrin can inhibit lipopolysaccharide-induced TNF-α release from either murine or human macrophage cells in a dose-dependent manner with the IC50 values of 8.24 and 3.18 μM, respectively. It can also inhibit the increase of cartilage degradation factor (MMP13) and suppresses NF-κB signaling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P333+P313-P362+P364-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
