PRODUCT Properties
| Melting point: | 100° |
| Boiling point: | 211.9℃[at 101 325 Pa] |
| Density | 971[at 20℃] |
| vapor pressure | 0.616Pa at 20℃ |
| solubility | insoluble in H2O; slightly soluble in ethanol; soluble in ethyl ether |
| form | blue-green solid |
| color | blue-green |
| Water Solubility | insoluble H2O; slightly soluble alcohol; soluble ether [MER06] |
| Dielectric constant | 2.8（20℃） |
| InChI | InChI=1S/C18H34O2.Cu/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/b10-9-; |
| InChIKey | XVBODFCHDIQCGK-KVVVOXFISA-N |
| SMILES | C(CCCCCC(=O)O)C/C=C\CCCCCCCC.[Cu] |
| LogP | 14.74 at 25℃ |
| EPA Substance Registry System | Cupric oleate (1120-44-1) |
Description and Uses
In antifouling compositions; as emulsifier and dispersing agent; as antioxidant in lubricating oils; as combustion-improver in fuel oils; as stabilizer for amide polymers; as catalyst.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411-H315-H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
