M1116835
Diethylmethylphosphonite , 97% , 15715-41-0
Synonym(s):
Diethoxymethylphosphine
CAS NO.：15715-41-0
Empirical Formula: C5H13O2P
Molecular Weight: 136.13
MDL number: MFCD00009089
EINECS: 239-805-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB182.40 | In Stock |
|
| 5g | RMB734.40 | In Stock |
|
| 25g | RMB2950.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 47 °C(Press: 50 Torr) |
| Density | 0,9 g/cm3 |
| refractive index | 1.4168 |
| Flash point: | 38°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Water Solubility | It slowly hydrolyses in water. |
| Sensitive | Air & Moisture Sensitive |
| Stability: | Air and Moisture Sensitive |
| InChI | InChI=1S/C5H13O2P/c1-4-6-8(3)7-5-2/h4-5H2,1-3H3 |
| InChIKey | NSSMTQDEWVTEKN-UHFFFAOYSA-N |
| SMILES | P(C)(OCC)OCC |
| EPA Substance Registry System | Phosphonous acid, methyl-, diethyl ester (15715-41-0) |
Description and Uses
Dimethyl methylphosphonate is a phosphonite reagent used in the generation of phosphinic acid derivative via Arbuzov reaction and as a cyclization reagentin the preparation of 2-substituted penems. It is a chiral intermediate.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302 |
| Precautionary statements | P210-P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 10-36/37/38-22 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
