M1542741
Cyproconazole? , ≥95% , 94361-06-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB318.40 | In Stock |
|
| 5g | RMB784.00 | In Stock |
|
| 25g | RMB2392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108℃ |
| Boiling point: | >250℃ |
| Density | 1.32 |
| vapor pressure | 3.46 x l0-5 Pa (20 °C) |
| refractive index | 1.6330 (estimate) |
| Flash point: | >100 °C |
| storage temp. | Store at -20°C |
| solubility | Soluble in acetone, ethanol, xylene, and dimethyl sulfoxide. |
| form | Solid |
| Water Solubility | 140 mg l-1(25 °C) |
| pka | 12.59±0.29(Predicted) |
| color | White to off-white |
| BRN | 8396421 |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C15H18ClN3O/c1-11(12-2-3-12)15(20,8-19-10-17-9-18-19)13-4-6-14(16)7-5-13/h4-7,9-12,20H,2-3,8H2,1H3 |
| InChIKey | UFNOUKDBUJZYDE-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)C(O)(Cn2cncn2)c3ccc(Cl)cc3 |
| LogP | 3.1 at 25℃ and pH7.2 |
| CAS DataBase Reference | 94361-06-5(CAS DataBase Reference) |
| EPA Substance Registry System | Cyproconazole (94361-06-5) |
Description and Uses
Cyproconazole is a fungicide treatment for wood preservative that prevents decay from fungi in above-ground applications.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H360D-H373-H410 |
| Precautionary statements | P201-P202-P260-P264-P273-P301+P310 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53-63 |
| Safety Statements | 36/37-60-61-36 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | XZ4803250 |
| HazardClass | 9 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B STOT RE 2 |
| Hazardous Substances Data | 94361-06-5(Hazardous Substances Data) |
| Toxicity | LD50 in male and female rats (mg/kg): 1020, 1330 orally; in rats: 2000 dermally; LD50 in carp: 18.9 mg/l; in trout 7.2 mg/l; in bluegill sunfish 6.0 mg/l in water; LD50 in bobwhite quail (mg/kg): 150 orally; LD50 (8 day dietary) in bobwhite quail, mallard duck: 816, 1197 mg/kg (Gisi, 1986) |








