M1784735
DL-Aminoglutethimide , ≥98% , 125-84-8
Synonym(s):
DL -Aminoglutethimide;3-(p-Aminophenyl)-3-ethylpiperidine-2,6-dione;3-(4-Aminophenyl)-3-ethyl-2,6-piperidinedione
CAS NO.:125-84-8
Empirical Formula: C13H16N2O2
Molecular Weight: 232.28
MDL number: MFCD00010122
EINECS: 204-756-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB86.40 | In Stock |
|
| 5g | RMB235.20 | In Stock |
|
| 25g | RMB840.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-154 °C(lit.) |
| Boiling point: | 374.44°C (rough estimate) |
| Density | 1.1099 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.2 mg/mL, slightly soluble |
| pka | 11.60±0.40(Predicted) |
| form | Solid |
| color | white |
| biological source | synthetic |
| Water Solubility | Soluble in water (2 mg/ml at 20°C), methanol (50 mg/ml), ethanol (7 mg/ml at 25°C), DMSO (20 mg/ml at 25°C), and chloroform. |
| Merck | 14,440 |
| InChI | 1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17) |
| InChIKey | ROBVIMPUHSLWNV-UHFFFAOYSA-N |
| SMILES | CCC1(CCC(=O)NC1=O)c2ccc(N)cc2 |
| CAS DataBase Reference | 125-84-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Aminoglutethimide(125-84-8) |
| EPA Substance Registry System | Aminoglutethimide (125-84-8) |
Description and Uses
Aminoglutethimide is an aromatase inhibitor (IC50 = 7.5 μM). Aromatase inhibitors, including aminoglutethimide, inhibit estrogen synthesis via aromatase, suppressing estrogen levels in post-menopausal women. Formulations containing aromatase inhibitors have been used to treat estrogen receptor-positive breast cancer in post-menopausal women.
aromatase inhibitor, antineoplastic, testosterone suppressant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | MA4026950 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2925190100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 125-84-8(Hazardous Substances Data) |





