7-Amino-4-methyl-3-coumarinaceticacidN-succinimidylester , 113721-87-2
Synonym(s):
N-Succinimidyl 7-amino-4-methyl-3-coumarinylacetate;7-(Dimethylamino)coumarin-4-acetic acid-NHS;7-Amino-4-methyl-3coumarinylacetyl;AMCA-NHS;Succinimidyl-7-amino-4-methylcoumarin-3-acetate
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB2096.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 559.4±60.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: soluble |
| pka | 1.69±0.20(Predicted) |
| form | A solid |
| Appearance | Light yellow solid |
| ex/em | 353/455 nm |
| ε(extinction coefficient) | 19000 L⋅mol−1⋅cm−1 |
| BRN | 9007679 |
| InChI | InChI=1S/C16H14N2O6/c1-8-10-3-2-9(17)6-12(10)23-16(22)11(8)7-15(21)24-18-13(19)4-5-14(18)20/h2-3,6H,4-5,7,17H2,1H3 |
| InChIKey | ILKQVTIMOGNSAS-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N)=CC=C2C(C)=C1CC(ON1C(=O)CCC1=O)=O |
Description and Uses
Activated NHS-ester of AMCA (aminomethyl coumarin acetate) dye. This NHS ester is an amine-reactive dye for labeling of amine groups in proteins, peptides, amino-modified oligos, and other target molecules.
AMCA is one of the brightest blue fluorescent dyes. This fluorophore has a relatively large Stoke’s shift, high resistance to photobleaching, and pH-independent fluorescence from pH 4 to 10. AMCA is a widely used fluorophore for multiple-color labeling due to its minimal fluorescence overlap with green- and longer wavelength-emitting fluorescent dyes.
AMCA-H NHS ester reacts with primary amines at pH 7.0-9.0. Suitable for labeling lysyl residues in proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 3212900000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







