M2271454
PhenylephrineEPImpurityD , 1367567-95-0
CAS NO.：1367567-95-0
Empirical Formula: C16H19NO2
Molecular Weight: 257.33
MDL number:
EINECS: 604-604-1
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108 - 113°C |
| Boiling point: | 437.5±40.0 °C(Predicted) |
| Density | 1.170±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.76±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C16H19NO2/c1-17(11-13-6-3-2-4-7-13)12-16(19)14-8-5-9-15(18)10-14/h2-10,16,18-19H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | JBBZPOHBHNEKIM-INIZCTEOSA-N |
| SMILES | N(C[C@H](O)c2cc(ccc2)O)(Cc1ccccc1)C |
Description and Uses
(αR)-3-Hydroxy-α-[[methyl(phenylmethyl)amino]methyl]-benzenemethanol (Phenylephrine USP Related Compound D) is a derivative of (R)-Phenylephrine (P320640, HCl salt) which is an α-Adrenergic agonist.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| HS Code | 2922504500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
