M2280254
MontelukastBis-sulfide(MixtureofDiastereomers) , 1187586-61-3
CAS NO.：1187586-61-3
Empirical Formula: C41H46ClNO5S2
Molecular Weight: 732.39
MDL number: MFCD21363698
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2520.00 | In Stock |
|
| 2.5mg | RMB5600.00 | In Stock |
|
| 50mg | RMB10640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-60°C |
| Boiling point: | 856.9±65.0 °C(Predicted) |
| Density | 1.302±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.76±0.10(Predicted) |
| form | Solid |
| color | Light Yellow to Yellow |
| InChIKey | SJNODSMYYCYZTO-LQFQNGICSA-N |
| SMILES | C1(CS[C@@H](C2=CC=CC([C@H](SCC3(CC(O)=O)CC3)CC3C=CC4C(N=3)=CC(Cl)=CC=4)=C2)CCC2=CC=CC=C2C(O)(C)C)(CC(O)=O)CC1 |
Description and Uses
Montelukast impurity.
