M2347254
9,9-DIMETHYL-9,10-DIHYDRO-ACRIDINE , 95% , 53884-62-1
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-126°C |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C15H15N/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10,16H,1-2H3 |
| InChIKey | JSEQNGYLWKBMJI-UHFFFAOYSA-N |
| SMILES | C1C2=C(NC3=C(C2(C)C)C=CC=C3)C=CC=1 |
Description and Uses
9,9-Dimethyl-9,10-dihydroacridine are currently being used in the development of thermally activated delayed fluorescence (TADF) molecules which are being researched for their possible efficient deep-?blue TADF emitting potential.
