M2410035
Ethylarachidonate , ≥90%(GC) , 1808-26-0
Synonym(s):
5,8,11,14-Eicosatetraenoic acid ethyl ester;Arachidonic acid ethyl ester
CAS NO.：1808-26-0
Empirical Formula: C22H36O2
Molecular Weight: 332.52
MDL number: MFCD00038340
EINECS: 217-314-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB308.80 | In Stock |
|
| 25g | RMB1030.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 418.1±34.0 °C(Predicted) |
| Density | 0.899±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |
| form | liquid |
| color | Clear Colorless |
| biological source | fungus |
| Stability: | Light Sensitive, Temperature Sensitive |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C22H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | SNXPWYFWAZVIAU-GKFVBPDJSA-N |
| SMILES | C(OCC)(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| LogP | 7.997 (est) |
| CAS DataBase Reference | 1808-26-0(CAS DataBase Reference) |
Description and Uses
Arachidonic acid (AA) is an unsaturated omega-6 fatty acid constituent of the phospholipids of cell membranes. Phospholipase A2 releases AA from the membrane phospholipids in response to inflammation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| RIDADR | 2845 |
| WGK Germany | 3 |
| RTECS | JX3855000 |
| HazardClass | 4.2 |
| PackingGroup | I |
