M2500635
Fenbutatinoxide , 100 μg/ml, u (%) = 2, medium: benzene , 13356-08-6
Synonym(s):
Bis[tris-(2-methyl-2-phenylpropyl)tin] oxide
CAS NO.：13356-08-6
Empirical Formula: C60H78OSn2
Molecular Weight: 1052.68
MDL number: MFCD00072480
EINECS: 236-407-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB296.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-145°C |
| Boiling point: | 235-240 °C(Press: 0.05 Torr) |
| Density | 0.42 g/cm3 |
| vapor pressure | 8.5×10-8 Pa (20 °C) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Very Slightly, Heated, Sonicated) |
| form | solid |
| Water Solubility | 0.005 mg l-1 (23 °C) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Merck | 13,3991 |
| InChI | InChI=1S/6C10H13.O.2Sn/c6*1-10(2,3)9-7-5-4-6-8-9;;;/h6*4-8H,1H2,2-3H3;;; |
| InChIKey | HOXINJBQVZWYGZ-UHFFFAOYSA-N |
| SMILES | [Sn](CC(C)(C1=CC=CC=C1)C)(CC(C)(C1=CC=CC=C1)C)(CC(C)(C1=CC=CC=C1)C)O[Sn](CC(C)(C1=CC=CC=C1)C)(CC(C)(C1=CC=CC=C1)C)CC(C)(C1=CC=CC=C1)C |
| EPA Substance Registry System | Fenbutatin oxide (13356-08-6) |
Description and Uses
Fenbutatin oxide is a non-systemic acaricide used to control a wide range of phytophagous mites on deciduous fruits, citrus, vines, selected nut crops, bananas, glasshouse crops and ornamentals.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H319-H330-H410 |
| Precautionary statements | P260-P264-P273-P302+P352-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn;N,N,Xn,T+ |
| Risk Statements | 21-36/38-50/53-26 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | JN8770000 |
| TSCA | Yes |
| HazardClass | 9 |
| PackingGroup | III |
| Hazardous Substances Data | 13356-08-6(Hazardous Substances Data) |
| Toxicity | LD50 in rats, rabbits (mg/kg): >2000 orally; >2000 percutaneously (Zweig) |
