M2550247
2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol , 97% , 329216-67-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB480.00 | In Stock |
|
| 1g | RMB1446.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >50°C (dec.) |
| Boiling point: | 523.4±60.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.96±0.10(Predicted) |
| color | White to Light Yellow |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C19H21N3OS/c23-14-13-21-9-11-22(12-10-21)19-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20-19/h1-8,23H,9-14H2 |
| InChIKey | OFLMIXVKBNAUIB-UHFFFAOYSA-N |
| SMILES | [s]1c2c(nc(c4c1cccc4)N3CCN(CC3)CCO)cccc2 |
Description and Uses
4-Dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazineethanol (Quetiapine EP Impurity I) is an antipsychotic drug.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H302-H335-H318 |
| Precautionary statements | P280-P305+P351+P338-P310-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| target organs | Central nervous system |
| WGK Germany | WGK 1 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 2 STOT SE 3 |

![2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethanol](https://img.chemicalbook.com/CAS/20200611/GIF/329216-67-3.gif)

![Dibenzo[b,f][1,4]thiazepine-11-[10H]one](https://img.chemicalbook.com/CAS/GIF/3159-07-7.gif)
![1,2-bis(2-(4-(Dibenzo[b,f][1,4]thiazepin-11-yl)piperazin-1-yl)ethoxy)ethane](https://img.chemicalbook.com/CAS/GIF/1371638-05-9.gif)
![11-(1-Piperazinyl)-dibenzo[b,f][1,4]thiazepine dihydrochloride](https://img.chemicalbook.com/CAS/GIF/111974-74-4.gif)

![2-(2-(4-(Dibenzo[b,f][1,4]thiazepin-11-yl)piperazin-1-yl)ethoxy)ethyl Acetate](https://img.chemicalbook.com/CAS/20150408/GIF/844639-07-2.gif)