PRODUCT Properties
| Melting point: | 194-197 °C |
| Boiling point: | 622.0±55.0 °C(Predicted) |
| Density | 1.332±0.06 g/cm3(Predicted) |
| storage temp. | -15°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 2.22±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | water: slightly soluble |
| Sequence | γ-Glu-Phe-OH |
| InChI | 1S/C14H18N2O5/c15-10(13(18)19)6-7-12(17)16-11(14(20)21)8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,15H2,(H,16,17)(H,18,19)(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | XHHOHZPNYFQJKL-QWRGUYRKSA-N |
| SMILES | N([C@@H](Cc1ccccc1)C(=O)O)C(=O)CC[C@H](N)C(=O)O |
Description and Uses
γ-Glutamylphenylalanine Trifluoroacetic Acid Salt is found in the urine of newborn untreated patients with phenylketonuria, and is not found in healthy patients. γ-Glutamylphenylalanine is a potential biomarker for the early detection of drug-induced nephrotoxicity
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
