M2968735
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-octane-1-sulfonamide , 90% , 754-91-6
CAS NO.:754-91-6
Empirical Formula: C8H2F17NO2S
Molecular Weight: 499.14
MDL number: MFCD03094345
EINECS: 212-046-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB172.80 | In Stock |
|
| 1g | RMB489.60 | In Stock |
|
| 5g | RMB1488.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-152 °C |
| Boiling point: | 227.2±50.0 °C(Predicted) |
| Density | 1.7595 (estimate) |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 7.01±0.60(Predicted) |
| color | Off-White |
| InChI | 1S/C8H2F17NO2S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H2,26,27,28) |
| InChIKey | RRRXPPIDPYTNJG-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 754-91-6(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorooctanesulfonamide (754-91-6) |
Description and Uses
Perfluorooctanesulfonamide is a longer chain fluorinated surfactant used in polymers. Used in aqueous film firm-forming foam to extinguish hydrocarbon-based fires.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H319-H335-H315-H410-H301 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P273-P391-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 53 |
| Safety Statements | 22-24/25 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 29241990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Lact. Repr. 1B STOT RE 1 |
| Hazardous Substances Data | 754-91-6(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: >172 mg/kg ATDAEI 15(Suppl 1),S104,1996 |





