M2969935
5beta-Hydroxycinobufagin , HPLC≥98% , 1108-68-5
Synonym(s):
14,15β-Epoxy-3β,5α,16β-trihydroxy-5β,20(22)-bufadienolide 16-acetate;5β,20(22)-Bufadienolide-14,15β-epoxy-3β,5α,16β-triol 16-acetate
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB864.00 | In Stock |
|
| 20mg | RMB2768.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-262° |
| alpha | D20 +11° |
| Boiling point: | 627.3±55.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 10 mg/ml; DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml; DMSO: 5 mg/ml; Ethanol: 5 mg/ml |
| pka | 14.67±0.70(Predicted) |
| form | White to off-white solid. |
| color | White to off-white |
| InChIKey | KBKUJJFDSHBPPA-XYCOMLSLNA-N |
| SMILES | [C@]123O[C@@H]1[C@@H]([C@H](C1=COC(=O)C=C1)[C@@]2(C)CC[C@]1([H])[C@@]2(C)CC[C@H](O)C[C@@]2(O)CC[C@@]31[H])OC(=O)C |&1:0,2,3,4,12,16,18,22,25,29,r| |
| CAS DataBase Reference | 1108-68-5 |
Description and Uses
Cinobufacin is an indole-type total alkaloid extracted from the dried toad skin of Chinese toad, which has the functions of clearing away heat and detoxifying, reducing swelling and pain, promoting blood circulation and removing blood stasis, softening and dispelling knots.
Cinobufotalin is a cardiotonic steroids or bufadienolides, is extracted from the skin secretions of the giant toads. Cinobufotalin has been used as a cardiotonic, diuretic and a hemostatic agent, Cinobufotalin is also a potential anti-lung cancer agent[1].
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | EI2991000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Toxicity | cat,LD50,intravenous,200ug/kg (0.2mg/kg),"Die Herzwirksamen Glykoside," Baumgarten, G., and W. Forster, Leipzig, Ger. Dem. Rep., VEB Georg Thieme, 1963Vol. -, Pg. 189, 1963. |



