M3065635
1,2,5,6,9,10-Hexabromocyclododecane , 99% , 3194-55-6
Synonym(s):
HBCD;HBCDD
CAS NO.:3194-55-6
Empirical Formula: C12H18Br6
Molecular Weight: 641.7
MDL number: MFCD00003716
EINECS: 221-695-9
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-191 °C |
| Boiling point: | 505.2±50.0 °C(Predicted) |
| Density | 2.145±0.06 g/cm3(Predicted) |
| solubility | acetone: soluble25mg/mL, clear, colorless to light yellow |
| BRN | 1911324 |
| InChI | InChI=1S/C12H18Br6/c13-7-1-2-8(14)10(16)5-6-12(18)11(17)4-3-9(7)15/h7-12H,1-6H2 |
| InChIKey | DEIGXXQKDWULML-UHFFFAOYSA-N |
| SMILES | C1(Br)CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br |
| CAS DataBase Reference | 3194-55-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,5,6,9,10-Hexabromocyclododecane (3194-55-6) |
Description and Uses
1,2,5,6,9,10-Hexabromocyclododecane(HBCD) was used to compare the efficiency of different advanced extraction techniques for the recovery of brominated flame retardants from styrenic polymers. It was used to study the kinetics of the thermal and photolytic segregation of HBCD using HPLC.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H361-H362-H410 |
| Precautionary statements | P202-P260-P263-P264-P273-P308+P313 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-64-50/53-63 |
| Safety Statements | 22-24/25-61-60-36/37-53 |
| RIDADR | 3077 |
| WGK Germany | 1 |
| RTECS | GU2302500 |
| F | 3-9 |
| HS Code | 29038900 |
| Hazardous Substances Data | 3194-55-6(Hazardous Substances Data) |






