PRODUCT Properties
| Melting point: | -108 °C (lit.) |
| Boiling point: | 69-73 °C (lit.) |
| Density | 2.013 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 53 °C |
| storage temp. | Flammables area |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Colourless to Light Yellow |
| BRN | 1840101 |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C2H5I/c1-2-3/h2H2,1H3 |
| InChIKey | HVTICUPFWKNHNG-UHFFFAOYSA-N |
| SMILES | C([H])([H])(I)C([H])([H])[H] |
| CAS Number Unlabeled | 75-03-6 |
Description and Uses
(Iodoethane-d5) Labeled 1-Iodoethane, which is used in a variety of organic chemical reactions including the synthesis if disubstituted α-amino acids through alkylation reaction. Also used in electrochemical reduction reactions in the preparation of carbamates.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T,Xn |
| Risk Statements | 23/24/25-42/43-63-36/37/38-22 |
| Safety Statements | 23-26-36/37/39-45-36/37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| RTECS | KI4750000 |
| F | 1-8-10 |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Muta. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







