PRODUCT Properties
| Melting point: | 180-182℃ |
| Boiling point: | 710.5±60.0 °C(Predicted) |
| Density | 1.172 |
| RTECS | NX7285000 |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Off-white solid. |
| pka | 7.70±0.20(Predicted) |
| color | White to light yellow |
| InChIKey | WVTKBKWTSCPRNU-PKGWHCLJNA-N |
| SMILES | O(C1C(=CC2CCN(C)[C@]3([H])CC4=CC=C(OC)C(OC5C=CC(=CC=5)C[C@]5([H])N(C)CCC6C=C(OC)C(=CC=65)OC=1C3=2)=C4)OC)C |&1:9,27,r| |
Description and Uses
A bisbenzylisoquinoline alkaloid, shown to be identical with berbamine methyl ether, this base occurs in A therosperrna rnoschaturn, Berberis japonica and Stephania cephalantha. It is dextrorotatory with [α]17D + 146° or[α]20D + 150.7° (c 0.85, CHC13). When recrystallized from MeOH it forms colourless crystals and furnishes a crystalline dimethiodide, m.p. 242°C. Four methoxyl groups and two methylimino groups are present.
Isotetrandrine is a biscoclaurine alkaloid inhibitor of G protein activation of PLA2.
