M3471535
L-DOPA-ring-d3L-DOPA-2,5,6-d3 , BR , 53587-29-4
Synonym(s):
3-(3,4-Dihydroxyphenyl-2,5,6-d3)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB752.00 | In Stock |
|
| 500mg | RMB2372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 292 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | Aqueous Acid (Sparingly) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]27/D 11.5°, c = 5 in 1 M HCl |
| Water Solubility | Water: sparingly soluble |
| Stability: | Light Sensitive |
| InChI | 1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1/i1D,2D,4D |
| InChIKey | WTDRDQBEARUVNC-UOCCHMHCSA-N |
| SMILES | [2H]c1c([2H])c(C[C@H](N)C(O)=O)c([2H])c(O)c1O |
| CAS DataBase Reference | 53587-29-4 |
| CAS Number Unlabeled | 59-92-7 |
Description and Uses
L-Dopa-(phenyl-d3) or (3-(3,4-dihydroxyphenyl-2,5,6-d3)-L-alanine) can be used as an internal standard for the quantification of methyldopa in human plasma by LC-MS-MS based method.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
