M3568635
Metolachlorstandardsolution , 100 μg/ml, u = 3%. Medical: methanol , 51218-45-2
Synonym(s):
2-Chloro-N-(2-ethyl-6-methylphenyl)-N-(-2-methoxy-1-methylethyl)acetamide
CAS NO.：51218-45-2
Empirical Formula: C15H22ClNO2
Molecular Weight: 283.79
MDL number: MFCD00055293
EINECS: 257-060-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | bp0.001 100° |
| Density | 1.1200 |
| refractive index | 1.526-1.529 |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 1.45±0.50(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| Odor | wh. to tan clear liq., odorless |
| Water Solubility | 529.7mg/L(20 ºC) |
| BRN | 8396147 |
| Henry's Law Constant | 7.5×102 mol/(m3Pa) at 25℃, Muir et al. (2004) |
| Major Application | agriculture environmental |
| InChI | 1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3 |
| InChIKey | WVQBLGZPHOPPFO-UHFFFAOYSA-N |
| SMILES | CCc1cccc(C)c1N(C(C)COC)C(=O)CCl |
| CAS DataBase Reference | 51218-45-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Metolachlor(51218-45-2) |
| EPA Substance Registry System | Metolachlor (51218-45-2) |
Description and Uses
Metolachlor is a colorless or tan to brown,oily liquid with a slightly sweet odor. Molecularweight 5 283.83; Boiling point = 100℃ at 0.001 mmHg. Itis stable to about 300℃. Hazard Identification (based onNFPA-704 M Rating System): Health 1, Flammability 0,Reactivity 0. Slightly soluble in water.
A selective pre-emergence herbicide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 43-36-20/21/22-11 |
| Safety Statements | 36/37-36-26-16 |
| RIDADR | UN1648 3/PG 2 |
| WGK Germany | 2 |
| RTECS | AN3430000 |
| HS Code | 29242990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 51218-45-2(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): 2780 orally; >3170 dermally (Gerber) |
