M3591957
GanodericacidH , ≥95% , 98665-19-1
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2744.00 | In Stock |
|
| 5mg | RMB8232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155～156℃ |
| Boiling point: | 710.0±60.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3 (20 ºC 760 Torr) |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 4.77±0.23(Predicted) |
| color | Off-white to light yellow |
| InChIKey | YCXUCEXEMJPDRZ-YIRLAGBYSA-N |
| SMILES | [C@@H]1(O)[C@@]([C@]2([C@](C)(CC1)C1=C([C@]3([C@@]([C@H](OC(C)=O)C1=O)(C)[C@@H]([C@H](C)CC(=O)CC(C)C(O)=O)CC3=O)C)C(=O)C2)[H])(C)C |
Description and Uses
Ganoderic Acid H, is a new lanostanoid triterpene extracted from the fruit bodies of Ganoderma Lucidum mushroom. these compounds are shown to possess many therapeutic properties. They can be used as anti-virus, anti-inflammation, anti-tumor, immunity-promoting, anti-diabetic, etc.
