M3650835
Magnesiummethylcarbonatesolution , 2.0MinDMF , 4861-79-4
Synonym(s):
Methoxymagnesium methyl carbonate;Methyl methoxymagnesium carbonate;MMC;Stile’s reagent
CAS NO.：4861-79-4
Empirical Formula: C3H6MgO4
Molecular Weight: 130.38
MDL number: MFCD00008418
EINECS: 225-466-4
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.103 g/mL at 25 °C |
| Flash point: | 52 °F |
| solubility | soluble in DMSO, Methanol |
| form | Clear Colourless Solution |
| Specific Gravity | 1.103 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 4342967 |
| InChI | InChI=1S/C2H4O3.CH3O.Mg/c1-5-2(3)4;1-2;/h1H3,(H,3,4);1H3;/q;-1;+2/p-1 |
| InChIKey | PNVKCUSCADAAMP-UHFFFAOYSA-M |
| SMILES | C(=O)(OC)O[Mg]OC |
| EPA Substance Registry System | Magnesium, methoxy(monomethyl carbonato-.kappa.O')- (4861-79-4) |
Description and Uses
Magnesium Methyl Carbonate Solution (2.0 M in DMF) is used to prepare synthetic oleanane and ursane triterpenoids as active inhibitors of nitric oxide production in mouse macrophages.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H312-H315-H331-H360D |
| Precautionary statements | P201-P202-P261-P280-P281-P308+P313-P311 |
| Hazard Codes | T,F |
| Risk Statements | 45-20/21/22-36/37/38-23/24/25-11-36/38-20/21-61 |
| Safety Statements | 53-26-27-36/37/39-45-38-16-36/37 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | Yes |
| HS Code | 28369910 |
