PRODUCT Properties
| Melting point: | 141-142℃ |
| Boiling point: | 339℃ |
| Density | 1.296 |
| Flash point: | 138℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.27±0.23(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H10O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4,10-11H,1-2H3 |
| InChIKey | NCCWCZLEACWJIN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=C(C)C=C(O)C=C1O |
| LogP | 2.380 (est) |
| EPA Substance Registry System | Benzoic acid, 2,4-dihydroxy-6-methyl-, methyl ester (3187-58-4) |
Description and Uses
Methyl 2,4-Dihydroxy-6-methylbenzoate (methyl orsellinate) is a useful synthetic intermediate in the synthesis of Grifolic Acid (G786500); a selective partial GPR120 agonist. Grifolic Acid induces ERK and [Ca2+]i responses in cells expressing GPR120, but has no effects on those expressing GPR40.
Safety
| HS Code | 2918290090 |
