M4077335
Melittoside? , 98% , 19467-03-9
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB958.40 | In Stock |
|
| 5mg | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-168 °C(Solv: methanol (67-56-1)) |
| storage temp. | -20°C, protect from light |
| solubility | PBS (pH 7.2): 10 mg/ml |
| form | A crystalline solid |
| color | White to light yellow |
| InChIKey | LZKBAGSBRBMVBE-GVKBFFPQSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@]32[C@H]([C@@H](OC=C3)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)C(=C[C@H]2O)CO |
Description and Uses
Used for content determination/identification/pharmacological experiments, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
