M4193853
trans-HeptachlorEpoxide , Analysis of the control, Isomera , 28044-83-9
Synonym(s):
cis-Heptachlor epoxide;exo-1,4,5,6,7,8,8-Heptachloro-2,3-epoxy-4,7-methano-3a,4,7,7a-tetrahydroindane;HCE;Heptachlor exo-epoxide solution
CAS NO.:28044-83-9
Empirical Formula: C10H5Cl7O
Molecular Weight: 389.32
MDL number: MFCD01311793
EINECS: 634-785-1
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB518.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 425.5±45.0 °C(Predicted) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| BRN | 8068917 |
| Major Application | agriculture environmental |
| InChI | 1S/C10H5Cl7O/c11-3-1-2(4-5(3)18-4)9(15)7(13)6(12)8(1,14)10(9,16)17/h1-5H/t1-,2+,3+,4+,5-,8?,9?/m0/s1 |
| InChIKey | ZXFXBSWRVIQKOD-BDMWXGRVSA-N |
| SMILES | [H][C@@]12O[C@]1([H])[C@@]3([H])[C@@]([H])([C@H]2Cl)C4(Cl)C(Cl)=C(Cl)C3(Cl)C4(Cl)Cl |
| EPA Substance Registry System | 2,5-Methano-2H-indeno[1,2-b]oxirene, 2,3,4,5,6,7,7-heptachloro-1a,1b,5,5a,6,6a-hexahydro-, (1aR,1bR,2S,5R,5aS,6R,6aR)-rel- (28044-83-9) |
Description and Uses
The trans-metabolite of organochlorine pesticide Heptachlor.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H351-H373-H410 |
| Precautionary statements | P202-P260-P264-P270-P273-P301+P310 |
| Hazard Codes | F,T,N |
| Risk Statements | 11-23/24/25-39/23/24/25-40-33-50/53-25-52/53 |
| Safety Statements | 7-16-45-36/37-61-60 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 3 |
| RTECS | PB9450000 |





