M4216335
N-Nitroso-di-iso-propylamine , Analysis of the control products, ≥98% , 601-77-4
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB524.80 | In Stock |
|
| 50mg | RMB1528.00 | In Stock |
|
| 100mg | RMB2656.00 | In Stock |
|
| 250mg | RMB5160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| Boiling point: | 194.5℃ |
| Density | 0.9422 |
| refractive index | 1.4431 (estimate) |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | Benzene (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -2.65±0.70(Predicted) |
| color | Off-White to Pale Yellow |
| Water Solubility | 13.02g/L(24 ºC) |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C6H14N2O/c1-5(2)8(7-9)6(3)4/h5-6H,1-4H3 |
| InChIKey | AUIKJTGFPFLMFP-UHFFFAOYSA-N |
| SMILES | CC(N(C(C)C)N=O)C |
| CAS DataBase Reference | 601-77-4 |
Description and Uses
A nitroso compound that shows carcinogenic effect
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H340-H350-H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| Risk Statements | 22-45 |
| Safety Statements | 53 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29211990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B |
| Toxicity | LD50 orl-rat: 850 mg/kg ZEKBAI 69,103,67 |





